C15H24N2O5 — CID 167407523
benzyl N-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]propyl]carbamate (PubChem CID 167407523) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is benzyl N-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]propyl]carbamate.
| Compound Name | benzyl N-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 167407523 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | benzyl N-[3-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]propyl]carbamate |
| SMILES | O=C(NCCCNC(CO)(CO)CO)OCc1ccccc1 |
| InChI | InChI=1S/C15H24N2O5/c18-10-15(11-19,12-20)17-8-4-7-16-14(21)22-9-13-5-2-1-3-6-13/h1-3,5-6,17-20H,4,7-12H2,(H,16,21) |
| InChIKey | UYAQLFVWORIKAI-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|