C22H20O4 — CID 16577341
(4-methoxyphenyl)methyl 2-hydroxy-2,2-diphenylacetate (PubChem CID 16577341) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-hydroxy-2,2-diphenylacetate.
| Compound Name | (4-methoxyphenyl)methyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 16577341 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-hydroxy-2,2-diphenylacetate |
| SMILES | COc1ccc(COC(=O)C(O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20O4/c1-25-20-14-12-17(13-15-20)16-26-21(23)22(24,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,24H,16H2,1H3 |
| InChIKey | TULOMTQOGZHRKR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |