About (4-methoxyphenyl)methyl phenyl carbonate
(4-methoxyphenyl)methyl phenyl carbonate (PubChem CID 3084543) has the molecular formula C15H14O4
and a molecular weight of 258.27 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl phenyl carbonate.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methyl phenyl carbonate |
| PubChem CID | 3084543 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (4-methoxyphenyl)methyl phenyl carbonate |
| SMILES | COc1ccc(COC(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C15H14O4/c1-17-13-9-7-12(8-10-13)11-18-15(16)19-14-5-3-2-4-6-14/h2-10H,11H2,1H3 |
| InChIKey | RMDRWXNFPZIFDS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl)methyl phenyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methyl phenyl carbonate?
The IUPAC name of (4-methoxyphenyl)methyl phenyl carbonate (CID 3084543) is (4-methoxyphenyl)methyl phenyl carbonate.
What is the SMILES notation for (4-methoxyphenyl)methyl phenyl carbonate?
The canonical SMILES for (4-methoxyphenyl)methyl phenyl carbonate is COc1ccc(COC(=O)Oc2ccccc2)cc1.
What is the InChIKey of (4-methoxyphenyl)methyl phenyl carbonate?
The InChIKey is RMDRWXNFPZIFDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O4/c1-17-13-9-7-12(8-10-13)11-18-15(16)19-14-5-3-2-4-6-14/h2-10H,11H2,1H3.
What are the key properties of (4-methoxyphenyl)methyl phenyl carbonate?
(4-methoxyphenyl)methyl phenyl carbonate has a molecular weight of 258.27 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyl phenyl carbonate is sourced from PubChem (CID 3084543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).