C33H39ClN2O4 — CID 158225317
benzyl N-[2-(4-methoxyphenyl)ethyl]carbamate;chloromethylbenzene;2-(4-methoxyphenyl)ethanamine (PubChem CID 158225317) has the molecular formula C33H39ClN2O4 and a molecular weight of 563.14 g/mol. Its IUPAC name is benzyl N-[2-(4-methoxyphenyl)ethyl]carbamate;chloromethylbenzene;2-(4-methoxyphenyl)ethanamine.
| Compound Name | benzyl N-[2-(4-methoxyphenyl)ethyl]carbamate;chloromethylbenzene;2-(4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 158225317 |
| Molecular Formula | C33H39ClN2O4 |
| Molecular Weight | 563.14 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | benzyl N-[2-(4-methoxyphenyl)ethyl]carbamate;chloromethylbenzene;2-(4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(CCN)cc1.COc1ccc(CCNC(=O)OCc2ccccc2)cc1.ClCc1ccccc1 |
| InChI | InChI=1S/C17H19NO3.C9H13NO.C7H7Cl/c1-20-16-9-7-14(8-10-16)11-12-18-17(19)21-13-15-5-3-2-4-6-15;1-11-9-4-2-8(3-5-9)6-7-10;8-6-7-4-2-1-3-5-7/h2-10H,11-13H2,1H3,(H,18,19);2-5H,6-7,10H2,1H3;1-5H,6H2 |
| InChIKey | GDSMWDWKXRQEHF-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.14 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|