About (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate
(4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate (PubChem CID 162509952) has the molecular formula C22H21NO3
and a molecular weight of 347.41 g/mol. Its IUPAC name is (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate.
Molecular Properties
| Compound Name | (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate |
| PubChem CID | 162509952 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate |
| SMILES | O=C(NCCc1ccc(O)cc1)OCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21NO3/c24-21-12-8-17(9-13-21)14-15-23-22(25)26-16-18-6-10-20(11-7-18)19-4-2-1-3-5-19/h1-13,24H,14-16H2,(H,23,25) |
| InChIKey | CMAWXPIDQOCTOE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate?
The IUPAC name of (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate (CID 162509952) is (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate.
What is the SMILES notation for (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate?
The canonical SMILES for (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate is O=C(NCCc1ccc(O)cc1)OCc1ccc(-c2ccccc2)cc1.
What is the InChIKey of (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate?
The InChIKey is CMAWXPIDQOCTOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO3/c24-21-12-8-17(9-13-21)14-15-23-22(25)26-16-18-6-10-20(11-7-18)19-4-2-1-3-5-19/h1-13,24H,14-16H2,(H,23,25).
What are the key properties of (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate?
(4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate has a molecular weight of 347.41 g/mol, XLogP of 4.53, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylphenyl)methyl N-[2-(4-hydroxyphenyl)ethyl]carbamate is sourced from PubChem (CID 162509952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).