C21H28ClN3O4 — CID 70268668
benzyl N-[(4R)-5-amino-4-[2-(4-hydroxyphenyl)ethylamino]-5-oxopentyl]carbamate;hydrochloride (PubChem CID 70268668) has the molecular formula C21H28ClN3O4 and a molecular weight of 421.93 g/mol. Its IUPAC name is benzyl N-[(4R)-5-amino-4-[2-(4-hydroxyphenyl)ethylamino]-5-oxopentyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[(4R)-5-amino-4-[2-(4-hydroxyphenyl)ethylamino]-5-oxopentyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 70268668 |
| Molecular Formula | C21H28ClN3O4 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | benzyl N-[(4R)-5-amino-4-[2-(4-hydroxyphenyl)ethylamino]-5-oxopentyl]carbamate;hydrochloride |
| SMILES | Cl.NC(=O)[C@@H](CCCNC(=O)OCc1ccccc1)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C21H27N3O4.ClH/c22-20(26)19(23-14-12-16-8-10-18(25)11-9-16)7-4-13-24-21(27)28-15-17-5-2-1-3-6-17;/h1-3,5-6,8-11,19,23,25H,4,7,12-15H2,(H2,22,26)(H,24,27);1H/t19-;/m1./s1 |
| InChIKey | PIAZGRYRMVUCLZ-FSRHSHDFSA-N |
| XLogP | 2.51 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|