C30H34N2O6 — CID 6733670
benzyl 5-(phenylmethoxycarbonylamino)-2-(3-phenylpropoxycarbonylamino)pentanoate (PubChem CID 6733670) has the molecular formula C30H34N2O6 and a molecular weight of 518.61 g/mol. Its IUPAC name is benzyl 5-(phenylmethoxycarbonylamino)-2-(3-phenylpropoxycarbonylamino)pentanoate.
| Compound Name | benzyl 5-(phenylmethoxycarbonylamino)-2-(3-phenylpropoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 6733670 |
| Molecular Formula | C30H34N2O6 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | benzyl 5-(phenylmethoxycarbonylamino)-2-(3-phenylpropoxycarbonylamino)pentanoate |
| SMILES | O=C(NCCCC(NC(=O)OCCCc1ccccc1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C30H34N2O6/c33-28(37-22-25-14-6-2-7-15-25)27(32-30(35)36-21-11-18-24-12-4-1-5-13-24)19-10-20-31-29(34)38-23-26-16-8-3-9-17-26/h1-9,12-17,27H,10-11,18-23H2,(H,31,34)(H,32,35) |
| InChIKey | QIYYIBGQSNAHDR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|