C20H28N2O3 — CID 158927905
2-(4-methoxyphenyl)ethanamine;N-[2-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 158927905) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)ethanamine;N-[2-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)ethanamine;N-[2-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 158927905 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-(4-methoxyphenyl)ethanamine;N-[2-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCN)cc1.COc1ccc(CCNC(C)=O)cc1 |
| InChI | InChI=1S/C11H15NO2.C9H13NO/c1-9(13)12-8-7-10-3-5-11(14-2)6-4-10;1-11-9-4-2-8(3-5-9)6-7-10/h3-6H,7-8H2,1-2H3,(H,12,13);2-5H,6-7,10H2,1H3 |
| InChIKey | JIRFDIIWBHEFLX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |