C16H22N2O5S — CID 10713118
(4-methoxyphenyl)methyl (2S,4S)-2-[(methoxycarbonylamino)methyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 10713118) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S,4S)-2-[(methoxycarbonylamino)methyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (2S,4S)-2-[(methoxycarbonylamino)methyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10713118 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S,4S)-2-[(methoxycarbonylamino)methyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | COC(=O)NC[C@@H]1C[C@H](S)CN1C(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H22N2O5S/c1-21-13-5-3-11(4-6-13)10-23-16(20)18-9-14(24)7-12(18)8-17-15(19)22-2/h3-6,12,14,24H,7-10H2,1-2H3,(H,17,19)/t12-,14-/m0/s1 |
| InChIKey | QBGIAQOECSYXMB-JSGCOSHPSA-N |
| XLogP | 2.06 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|