C17H21N3O5S — CID 10523761
(4-methoxyphenyl)methyl (2S,4S)-2-[(2,4-dioxoimidazolidin-1-yl)methyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 10523761) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S,4S)-2-[(2,4-dioxoimidazolidin-1-yl)methyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (2S,4S)-2-[(2,4-dioxoimidazolidin-1-yl)methyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10523761 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S,4S)-2-[(2,4-dioxoimidazolidin-1-yl)methyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | COc1ccc(COC(=O)N2C[C@@H](S)C[C@H]2CN2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C17H21N3O5S/c1-24-13-4-2-11(3-5-13)10-25-17(23)20-8-14(26)6-12(20)7-19-9-15(21)18-16(19)22/h2-5,12,14,26H,6-10H2,1H3,(H,18,21,22)/t12-,14-/m0/s1 |
| InChIKey | PETHFBIJVWHVMO-JSGCOSHPSA-N |
| XLogP | 1.26 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|