C14H21N3O5S2 — CID 142640298
(4-methoxyphenyl)methyl (2S,4S)-2-methyl-2-(sulfamoylamino)-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 142640298) has the molecular formula C14H21N3O5S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S,4S)-2-methyl-2-(sulfamoylamino)-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (2S,4S)-2-methyl-2-(sulfamoylamino)-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142640298 |
| Molecular Formula | C14H21N3O5S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S,4S)-2-methyl-2-(sulfamoylamino)-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | COc1ccc(COC(=O)N2C[C@@H](S)C[C@]2(C)NS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H21N3O5S2/c1-14(16-24(15,19)20)7-12(23)8-17(14)13(18)22-9-10-3-5-11(21-2)6-4-10/h3-6,12,16,23H,7-9H2,1-2H3,(H2,15,19,20)/t12-,14+/m0/s1 |
| InChIKey | RVTIMGNDEAEORG-GXTWGEPZSA-N |
| XLogP | 0.85 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|