C22H23N3O8S — CID 173348266
(4-nitrophenyl)methyl (4S)-2-[2-[(4-methoxyphenyl)methoxy]-2-oxoethoxy]imino-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 173348266) has the molecular formula C22H23N3O8S and a molecular weight of 489.51 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4S)-2-[2-[(4-methoxyphenyl)methoxy]-2-oxoethoxy]imino-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4S)-2-[2-[(4-methoxyphenyl)methoxy]-2-oxoethoxy]imino-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173348266 |
| Molecular Formula | C22H23N3O8S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | (4-nitrophenyl)methyl (4S)-2-[2-[(4-methoxyphenyl)methoxy]-2-oxoethoxy]imino-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | COc1ccc(COC(=O)CON=C2C[C@H](S)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H23N3O8S/c1-30-18-8-4-16(5-9-18)12-31-21(26)14-33-23-20-10-19(34)11-24(20)22(27)32-13-15-2-6-17(7-3-15)25(28)29/h2-9,19,34H,10-14H2,1H3/t19-/m0/s1 |
| InChIKey | NBJLOGZGKFOLBM-IBGZPJMESA-N |
| XLogP | 3.32 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|