C24H26N2O8S — CID 22846248
2-O-[(4-methoxyphenyl)methyl] 1-O-[(4-nitrophenyl)methyl] (2S,5S)-5-acetylsulfanylpiperidine-1,2-dicarboxylate (PubChem CID 22846248) has the molecular formula C24H26N2O8S and a molecular weight of 502.55 g/mol. Its IUPAC name is 2-O-[(4-methoxyphenyl)methyl] 1-O-[(4-nitrophenyl)methyl] (2S,5S)-5-acetylsulfanylpiperidine-1,2-dicarboxylate.
| Compound Name | 2-O-[(4-methoxyphenyl)methyl] 1-O-[(4-nitrophenyl)methyl] (2S,5S)-5-acetylsulfanylpiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 22846248 |
| Molecular Formula | C24H26N2O8S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 2-O-[(4-methoxyphenyl)methyl] 1-O-[(4-nitrophenyl)methyl] (2S,5S)-5-acetylsulfanylpiperidine-1,2-dicarboxylate |
| SMILES | COc1ccc(COC(=O)[C@@H]2CC[C@H](SC(C)=O)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H26N2O8S/c1-16(27)35-21-11-12-22(23(28)33-14-18-5-9-20(32-2)10-6-18)25(13-21)24(29)34-15-17-3-7-19(8-4-17)26(30)31/h3-10,21-22H,11-15H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | WLRMJCFESAGUSX-VXKWHMMOSA-N |
| XLogP | 4.10 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|