C21H28N4O7S — CID 142640268
(4-nitrophenyl)methyl 4-acetylsulfanyl-2-[4-(2-hydroxyethyl)piperazine-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 142640268) has the molecular formula C21H28N4O7S and a molecular weight of 480.54 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-acetylsulfanyl-2-[4-(2-hydroxyethyl)piperazine-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 4-acetylsulfanyl-2-[4-(2-hydroxyethyl)piperazine-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142640268 |
| Molecular Formula | C21H28N4O7S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | (4-nitrophenyl)methyl 4-acetylsulfanyl-2-[4-(2-hydroxyethyl)piperazine-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)SC1CC(C(=O)N2CCN(CCO)CC2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C21H28N4O7S/c1-15(27)33-18-12-19(20(28)23-8-6-22(7-9-23)10-11-26)24(13-18)21(29)32-14-16-2-4-17(5-3-16)25(30)31/h2-5,18-19,26H,6-14H2,1H3 |
| InChIKey | JUPXNXQHDISUQA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|