C28H30N4O8S — CID 139709267
prop-2-enyl 4-[(2S,4S)-4-benzoylsulfanyl-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carbonyl]piperazine-1-carboxylate (PubChem CID 139709267) has the molecular formula C28H30N4O8S and a molecular weight of 582.64 g/mol. Its IUPAC name is prop-2-enyl 4-[(2S,4S)-4-benzoylsulfanyl-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | prop-2-enyl 4-[(2S,4S)-4-benzoylsulfanyl-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139709267 |
| Molecular Formula | C28H30N4O8S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | prop-2-enyl 4-[(2S,4S)-4-benzoylsulfanyl-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carbonyl]piperazine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCN(C(=O)[C@@H]2C[C@H](SC(=O)c3ccccc3)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C28H30N4O8S/c1-2-16-39-27(35)30-14-12-29(13-15-30)25(33)24-17-23(41-26(34)21-6-4-3-5-7-21)18-31(24)28(36)40-19-20-8-10-22(11-9-20)32(37)38/h2-11,23-24H,1,12-19H2/t23-,24-/m0/s1 |
| InChIKey | LFEJEEXGWOSTFG-ZEQRLZLVSA-N |
| XLogP | 3.71 |
| TPSA | 139.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|