C22H29N3O5S — CID 57289162
prop-2-enyl (2S,4S)-2-[4-(2-oxo-2-phenylmethoxyethyl)piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 57289162) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-2-[4-(2-oxo-2-phenylmethoxyethyl)piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-2-[4-(2-oxo-2-phenylmethoxyethyl)piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57289162 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | prop-2-enyl (2S,4S)-2-[4-(2-oxo-2-phenylmethoxyethyl)piperazine-1-carbonyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](S)C[C@H]1C(=O)N1CCN(CC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N3O5S/c1-2-12-29-22(28)25-14-18(31)13-19(25)21(27)24-10-8-23(9-11-24)15-20(26)30-16-17-6-4-3-5-7-17/h2-7,18-19,31H,1,8-16H2/t18-,19-/m0/s1 |
| InChIKey | DOISIBFEZCHCQU-OALUTQOASA-N |
| XLogP | 1.57 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|