C21H26N4O8 — CID 139709258
prop-2-enyl 4-[(2S,4R)-4-hydroxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carbonyl]piperazine-1-carboxylate (PubChem CID 139709258) has the molecular formula C21H26N4O8 and a molecular weight of 462.46 g/mol. Its IUPAC name is prop-2-enyl 4-[(2S,4R)-4-hydroxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | prop-2-enyl 4-[(2S,4R)-4-hydroxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139709258 |
| Molecular Formula | C21H26N4O8 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | prop-2-enyl 4-[(2S,4R)-4-hydroxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carbonyl]piperazine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCN(C(=O)[C@@H]2C[C@@H](O)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H26N4O8/c1-2-11-32-20(28)23-9-7-22(8-10-23)19(27)18-12-17(26)13-24(18)21(29)33-14-15-3-5-16(6-4-15)25(30)31/h2-6,17-18,26H,1,7-14H2/t17-,18+/m1/s1 |
| InChIKey | RXPBRQJSHBFTRD-MSOLQXFVSA-N |
| XLogP | 1.13 |
| TPSA | 142.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|