C24H26N4O9 — CID 10673368
(4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[(3R)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]pyrrolidine-1-carboxylate (PubChem CID 10673368) has the molecular formula C24H26N4O9 and a molecular weight of 514.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[(3R)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[(3R)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10673368 |
| Molecular Formula | C24H26N4O9 |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[(3R)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)N1CC[C@@H]([C@@H]2C[C@@H](O)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C24H26N4O9/c29-21-11-22(26(13-21)24(31)37-15-17-3-7-20(8-4-17)28(34)35)18-9-10-25(12-18)23(30)36-14-16-1-5-19(6-2-16)27(32)33/h1-8,18,21-22,29H,9-15H2/t18-,21-,22+/m1/s1 |
| InChIKey | YMOBPAIQGKBJBI-QIJUGHKUSA-N |
| XLogP | 3.23 |
| TPSA | 165.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|