C13H17N3O7S — CID 139463055
(4-nitrophenyl)methyl (3S,5R)-3-hydroxy-5-sulfamoylpiperidine-1-carboxylate (PubChem CID 139463055) has the molecular formula C13H17N3O7S and a molecular weight of 359.36 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (3S,5R)-3-hydroxy-5-sulfamoylpiperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (3S,5R)-3-hydroxy-5-sulfamoylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 139463055 |
| Molecular Formula | C13H17N3O7S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (4-nitrophenyl)methyl (3S,5R)-3-hydroxy-5-sulfamoylpiperidine-1-carboxylate |
| SMILES | NS(=O)(=O)[C@@H]1C[C@H](O)CN(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C13H17N3O7S/c14-24(21,22)12-5-11(17)6-15(7-12)13(18)23-8-9-1-3-10(4-2-9)16(19)20/h1-4,11-12,17H,5-8H2,(H2,14,21,22)/t11-,12+/m0/s1 |
| InChIKey | NMGPPNUZXIIHIP-NWDGAFQWSA-N |
| XLogP | -0.04 |
| TPSA | 153.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|