C23H26N4O10 — CID 11800078
(4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[(1R)-1-hydroxy-3-[(4-nitrophenyl)methoxycarbonylamino]propyl]pyrrolidine-1-carboxylate (PubChem CID 11800078) has the molecular formula C23H26N4O10 and a molecular weight of 518.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[(1R)-1-hydroxy-3-[(4-nitrophenyl)methoxycarbonylamino]propyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[(1R)-1-hydroxy-3-[(4-nitrophenyl)methoxycarbonylamino]propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11800078 |
| Molecular Formula | C23H26N4O10 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[(1R)-1-hydroxy-3-[(4-nitrophenyl)methoxycarbonylamino]propyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(NCC[C@@H](O)[C@@H]1C[C@@H](O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H26N4O10/c28-19-11-20(25(12-19)23(31)37-14-16-3-7-18(8-4-16)27(34)35)21(29)9-10-24-22(30)36-13-15-1-5-17(6-2-15)26(32)33/h1-8,19-21,28-29H,9-14H2,(H,24,30)/t19-,20+,21-/m1/s1 |
| InChIKey | AXGZKFBKBSBFNE-QHAWAJNXSA-N |
| XLogP | 2.25 |
| TPSA | 194.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|