C16H24ClN5O6 — CID 86744298
(4-nitrophenyl)methyl (2S,4R)-2-[[2-(carbamoylamino)ethylamino]methyl]-4-hydroxypyrrolidine-1-carboxylate;hydrochloride (PubChem CID 86744298) has the molecular formula C16H24ClN5O6 and a molecular weight of 417.85 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-2-[[2-(carbamoylamino)ethylamino]methyl]-4-hydroxypyrrolidine-1-carboxylate;hydrochloride.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-2-[[2-(carbamoylamino)ethylamino]methyl]-4-hydroxypyrrolidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 86744298 |
| Molecular Formula | C16H24ClN5O6 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-2-[[2-(carbamoylamino)ethylamino]methyl]-4-hydroxypyrrolidine-1-carboxylate;hydrochloride |
| SMILES | Cl.NC(=O)NCCNC[C@@H]1C[C@@H](O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H23N5O6.ClH/c17-15(23)19-6-5-18-8-13-7-14(22)9-20(13)16(24)27-10-11-1-3-12(4-2-11)21(25)26;/h1-4,13-14,18,22H,5-10H2,(H3,17,19,23);1H/t13-,14+;/m0./s1 |
| InChIKey | WTKPIQQUBCBHAV-LMRHVHIWSA-N |
| XLogP | 0.35 |
| TPSA | 160.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|