C14H16F2N2O5S — CID 56991440
(4-nitrophenyl)methyl (2S,4R)-2-(difluoromethylsulfanylmethyl)-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 56991440) has the molecular formula C14H16F2N2O5S and a molecular weight of 362.35 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-2-(difluoromethylsulfanylmethyl)-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-2-(difluoromethylsulfanylmethyl)-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 56991440 |
| Molecular Formula | C14H16F2N2O5S |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-2-(difluoromethylsulfanylmethyl)-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)N1C[C@H](O)C[C@H]1CSC(F)F |
| InChI | InChI=1S/C14H16F2N2O5S/c15-13(16)24-8-11-5-12(19)6-17(11)14(20)23-7-9-1-3-10(4-2-9)18(21)22/h1-4,11-13,19H,5-8H2/t11-,12+/m0/s1 |
| InChIKey | UCLDCYKLHGAWES-NWDGAFQWSA-N |
| XLogP | 2.62 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|