C16H21N3O8S — CID 139608447
(4-nitrophenyl)methyl (2S,4R)-2-(acetamidomethyl)-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 139608447) has the molecular formula C16H21N3O8S and a molecular weight of 415.42 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-2-(acetamidomethyl)-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-2-(acetamidomethyl)-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139608447 |
| Molecular Formula | C16H21N3O8S |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-2-(acetamidomethyl)-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CC(=O)NC[C@@H]1C[C@@H](OS(C)(=O)=O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H21N3O8S/c1-11(20)17-8-14-7-15(27-28(2,24)25)9-18(14)16(21)26-10-12-3-5-13(6-4-12)19(22)23/h3-6,14-15H,7-10H2,1-2H3,(H,17,20)/t14-,15+/m0/s1 |
| InChIKey | KQAAHKSECDALTD-LSDHHAIUSA-N |
| XLogP | 0.79 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|