C19H24N4O9S — CID 15056165
(4-nitrophenyl)methyl (2S,4R)-2-[(3-acetyl-2-oxoimidazolidin-1-yl)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 15056165) has the molecular formula C19H24N4O9S and a molecular weight of 484.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-2-[(3-acetyl-2-oxoimidazolidin-1-yl)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-2-[(3-acetyl-2-oxoimidazolidin-1-yl)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15056165 |
| Molecular Formula | C19H24N4O9S |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-2-[(3-acetyl-2-oxoimidazolidin-1-yl)methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CC(=O)N1CCN(C[C@@H]2C[C@@H](OS(C)(=O)=O)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C19H24N4O9S/c1-13(24)21-8-7-20(18(21)25)10-16-9-17(32-33(2,29)30)11-22(16)19(26)31-12-14-3-5-15(6-4-14)23(27)28/h3-6,16-17H,7-12H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | WKEFDHKHNGZCCD-DLBZAZTESA-N |
| XLogP | 0.93 |
| TPSA | 156.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|