C20H28N4O9S — CID 86752003
(4-nitrophenyl)methyl (2S,4R)-2-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 86752003) has the molecular formula C20H28N4O9S and a molecular weight of 500.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-2-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-2-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86752003 |
| Molecular Formula | C20H28N4O9S |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-2-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CS(=O)(=O)O[C@@H]1C[C@@H](C(=O)N2CCN(CCO)CC2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C20H28N4O9S/c1-34(30,31)33-17-12-18(19(26)22-8-6-21(7-9-22)10-11-25)23(13-17)20(27)32-14-15-2-4-16(5-3-15)24(28)29/h2-5,17-18,25H,6-14H2,1H3/t17-,18+/m1/s1 |
| InChIKey | XMIPVXUDKVLAAU-MSOLQXFVSA-N |
| XLogP | -0.21 |
| TPSA | 159.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|