C27H31N5O11 — CID 86753701
(4-nitrophenyl)methyl (2R,4S)-4-hydroxy-2-[4-[2-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]piperazine-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 86753701) has the molecular formula C27H31N5O11 and a molecular weight of 601.57 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,4S)-4-hydroxy-2-[4-[2-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]piperazine-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,4S)-4-hydroxy-2-[4-[2-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]piperazine-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86753701 |
| Molecular Formula | C27H31N5O11 |
| Molecular Weight | 601.57 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,4S)-4-hydroxy-2-[4-[2-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]piperazine-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCCN1CCN(C(=O)[C@H]2C[C@H](O)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)CC1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H31N5O11/c33-23-15-24(30(16-23)26(35)42-17-19-1-5-21(6-2-19)31(37)38)25(34)29-11-9-28(10-12-29)13-14-41-27(36)43-18-20-3-7-22(8-4-20)32(39)40/h1-8,23-24,33H,9-18H2/t23-,24+/m0/s1 |
| InChIKey | MEWVBDYDQABOMG-BJKOFHAPSA-N |
| XLogP | 2.07 |
| TPSA | 195.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|