C19H22N6O6 — CID 141232803
(4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-(3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 141232803) has the molecular formula C19H22N6O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-(3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl)pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-(3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 141232803 |
| Molecular Formula | C19H22N6O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-(3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | Cc1nnc2n1CCN(C(=O)[C@@H]1C[C@@H](O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1)C2 |
| InChI | InChI=1S/C19H22N6O6/c1-12-20-21-17-10-22(6-7-23(12)17)18(27)16-8-15(26)9-24(16)19(28)31-11-13-2-4-14(5-3-13)25(29)30/h2-5,15-16,26H,6-11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | GXGKGKNXYWCEQW-CVEARBPZSA-N |
| XLogP | 0.61 |
| TPSA | 143.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|