C19H23N3O8S — CID 101038046
(4-nitrophenyl)methyl (2S,4R)-4-acetylsulfanyl-2-[(3R,4R)-3,4-dihydroxypyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 101038046) has the molecular formula C19H23N3O8S and a molecular weight of 453.47 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-4-acetylsulfanyl-2-[(3R,4R)-3,4-dihydroxypyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-4-acetylsulfanyl-2-[(3R,4R)-3,4-dihydroxypyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101038046 |
| Molecular Formula | C19H23N3O8S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-4-acetylsulfanyl-2-[(3R,4R)-3,4-dihydroxypyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)S[C@@H]1C[C@@H](C(=O)N2C[C@@H](O)[C@H](O)C2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C19H23N3O8S/c1-11(23)31-14-6-15(18(26)20-8-16(24)17(25)9-20)21(7-14)19(27)30-10-12-2-4-13(5-3-12)22(28)29/h2-5,14-17,24-25H,6-10H2,1H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | CPTUHRYEQLCLRW-YYIAUSFCSA-N |
| XLogP | 0.52 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|