C27H32N4O11S2 — CID 139616524
(4-nitrophenyl)methyl 2-[(2S,4R)-4-methylsulfonyloxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]-1,5-thiazocane-5-carboxylate (PubChem CID 139616524) has the molecular formula C27H32N4O11S2 and a molecular weight of 652.70 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2S,4R)-4-methylsulfonyloxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]-1,5-thiazocane-5-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2S,4R)-4-methylsulfonyloxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]-1,5-thiazocane-5-carboxylate |
|---|---|
| PubChem CID | 139616524 |
| Molecular Formula | C27H32N4O11S2 |
| Molecular Weight | 652.70 g/mol |
| Exact Mass | 652.15 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2S,4R)-4-methylsulfonyloxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]-1,5-thiazocane-5-carboxylate |
| SMILES | CS(=O)(=O)O[C@@H]1C[C@@H](C2CCN(C(=O)OCc3ccc([N+](=O)[O-])cc3)CCCS2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C27H32N4O11S2/c1-44(38,39)42-23-15-24(29(16-23)27(33)41-18-20-5-9-22(10-6-20)31(36)37)25-11-13-28(12-2-14-43-25)26(32)40-17-19-3-7-21(8-4-19)30(34)35/h3-10,23-25H,2,11-18H2,1H3/t23-,24+,25?/m1/s1 |
| InChIKey | FSAXHKVAXKVYMY-CSIQULDISA-N |
| XLogP | 4.09 |
| TPSA | 188.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|