C24H26N4O8S2 — CID 10745495
(4-nitrophenyl)methyl 2-[(2S,4S)-1-[(4-nitrophenyl)methoxycarbonyl]-4-sulfanylpyrrolidin-2-yl]thiomorpholine-4-carboxylate (PubChem CID 10745495) has the molecular formula C24H26N4O8S2 and a molecular weight of 562.63 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2S,4S)-1-[(4-nitrophenyl)methoxycarbonyl]-4-sulfanylpyrrolidin-2-yl]thiomorpholine-4-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2S,4S)-1-[(4-nitrophenyl)methoxycarbonyl]-4-sulfanylpyrrolidin-2-yl]thiomorpholine-4-carboxylate |
|---|---|
| PubChem CID | 10745495 |
| Molecular Formula | C24H26N4O8S2 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2S,4S)-1-[(4-nitrophenyl)methoxycarbonyl]-4-sulfanylpyrrolidin-2-yl]thiomorpholine-4-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)N1CCSC([C@@H]2C[C@H](S)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C24H26N4O8S2/c29-23(35-14-16-1-5-18(6-2-16)27(31)32)25-9-10-38-22(13-25)21-11-20(37)12-26(21)24(30)36-15-17-3-7-19(8-4-17)28(33)34/h1-8,20-22,37H,9-15H2/t20-,21-,22?/m0/s1 |
| InChIKey | WLWOXXVEWRZMNN-LGTSYYJHSA-N |
| XLogP | 4.27 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|