C21H28N4O5S3 — CID 142660024
(4-nitrophenyl)methyl 4-sulfanyl-2-[3-(2-thiomorpholin-4-ylacetyl)-1,3-thiazolidin-2-yl]pyrrolidine-1-carboxylate (PubChem CID 142660024) has the molecular formula C21H28N4O5S3 and a molecular weight of 512.68 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-sulfanyl-2-[3-(2-thiomorpholin-4-ylacetyl)-1,3-thiazolidin-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 4-sulfanyl-2-[3-(2-thiomorpholin-4-ylacetyl)-1,3-thiazolidin-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142660024 |
| Molecular Formula | C21H28N4O5S3 |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | (4-nitrophenyl)methyl 4-sulfanyl-2-[3-(2-thiomorpholin-4-ylacetyl)-1,3-thiazolidin-2-yl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)N1CC(S)CC1C1SCCN1C(=O)CN1CCSCC1 |
| InChI | InChI=1S/C21H28N4O5S3/c26-19(13-22-5-8-32-9-6-22)23-7-10-33-20(23)18-11-17(31)12-24(18)21(27)30-14-15-1-3-16(4-2-15)25(28)29/h1-4,17-18,20,31H,5-14H2 |
| InChIKey | BBUNSSCHCXARKD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|