C14H14N4O4S2 — CID 19884145
(4-nitrophenyl)methyl 4-sulfanyl-2-(1,2,4-thiadiazol-5-yl)pyrrolidine-1-carboxylate (PubChem CID 19884145) has the molecular formula C14H14N4O4S2 and a molecular weight of 366.42 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-sulfanyl-2-(1,2,4-thiadiazol-5-yl)pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 4-sulfanyl-2-(1,2,4-thiadiazol-5-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 19884145 |
| Molecular Formula | C14H14N4O4S2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (4-nitrophenyl)methyl 4-sulfanyl-2-(1,2,4-thiadiazol-5-yl)pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)N1CC(S)CC1c1ncns1 |
| InChI | InChI=1S/C14H14N4O4S2/c19-14(22-7-9-1-3-10(4-2-9)18(20)21)17-6-11(23)5-12(17)13-15-8-16-24-13/h1-4,8,11-12,23H,5-7H2 |
| InChIKey | MWIXLNAZSDJTQH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|