C23H23N7O8S — CID 139695084
(4-nitrophenyl)methyl (2S,4S)-2-[2-[[(4-nitrophenyl)methoxycarbonylamino]methyl]-1,2,4-triazol-3-yl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 139695084) has the molecular formula C23H23N7O8S and a molecular weight of 557.55 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-2-[2-[[(4-nitrophenyl)methoxycarbonylamino]methyl]-1,2,4-triazol-3-yl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-2-[2-[[(4-nitrophenyl)methoxycarbonylamino]methyl]-1,2,4-triazol-3-yl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139695084 |
| Molecular Formula | C23H23N7O8S |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-2-[2-[[(4-nitrophenyl)methoxycarbonylamino]methyl]-1,2,4-triazol-3-yl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | O=C(NCn1ncnc1[C@@H]1C[C@H](S)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H23N7O8S/c31-22(37-11-15-1-5-17(6-2-15)29(33)34)25-14-28-21(24-13-26-28)20-9-19(39)10-27(20)23(32)38-12-16-3-7-18(8-4-16)30(35)36/h1-8,13,19-20,39H,9-12,14H2,(H,25,31)/t19-,20-/m0/s1 |
| InChIKey | UNDOIKZLYFVWKX-PMACEKPBSA-N |
| XLogP | 3.36 |
| TPSA | 184.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|