C18H22N6O4S — CID 56983846
(4-nitrophenyl)methyl (2S,4S)-4-sulfanyl-2-[(3S)-3-(1,2,4-triazol-1-yl)pyrrolidin-1-yl]pyrrolidine-1-carboxylate (PubChem CID 56983846) has the molecular formula C18H22N6O4S and a molecular weight of 418.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-sulfanyl-2-[(3S)-3-(1,2,4-triazol-1-yl)pyrrolidin-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-sulfanyl-2-[(3S)-3-(1,2,4-triazol-1-yl)pyrrolidin-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 56983846 |
| Molecular Formula | C18H22N6O4S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-sulfanyl-2-[(3S)-3-(1,2,4-triazol-1-yl)pyrrolidin-1-yl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)N1C[C@@H](S)C[C@H]1N1CC[C@H](n2cncn2)C1 |
| InChI | InChI=1S/C18H22N6O4S/c25-18(28-10-13-1-3-14(4-2-13)24(26)27)22-9-16(29)7-17(22)21-6-5-15(8-21)23-12-19-11-20-23/h1-4,11-12,15-17,29H,5-10H2/t15-,16-,17-/m0/s1 |
| InChIKey | ZTYDPUWRJVCNIS-ULQDDVLXSA-N |
| XLogP | 2.10 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|