C18H19N3O8S — CID 173270117
(4-nitrophenyl)methyl (2S,4S)-4-methylsulfonyloxy-2-[2-(1,2-oxazol-5-yl)ethenyl]pyrrolidine-1-carboxylate (PubChem CID 173270117) has the molecular formula C18H19N3O8S and a molecular weight of 437.43 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4S)-4-methylsulfonyloxy-2-[2-(1,2-oxazol-5-yl)ethenyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4S)-4-methylsulfonyloxy-2-[2-(1,2-oxazol-5-yl)ethenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173270117 |
| Molecular Formula | C18H19N3O8S |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4S)-4-methylsulfonyloxy-2-[2-(1,2-oxazol-5-yl)ethenyl]pyrrolidine-1-carboxylate |
| SMILES | CS(=O)(=O)O[C@H]1C[C@@H](C=Cc2ccno2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C18H19N3O8S/c1-30(25,26)29-17-10-15(6-7-16-8-9-19-28-16)20(11-17)18(22)27-12-13-2-4-14(5-3-13)21(23)24/h2-9,15,17H,10-12H2,1H3/t15-,17+/m1/s1 |
| InChIKey | HCZSYBMXBMASBV-WBVHZDCISA-N |
| XLogP | 2.35 |
| TPSA | 142.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|