C19H28N2O6Si — CID 88524516
(4-nitrophenyl)methyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpyrrolidine-1-carboxylate (PubChem CID 88524516) has the molecular formula C19H28N2O6Si and a molecular weight of 408.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88524516 |
| Molecular Formula | C19H28N2O6Si |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H](C=O)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C19H28N2O6Si/c1-19(2,3)28(4,5)27-17-10-16(12-22)20(11-17)18(23)26-13-14-6-8-15(9-7-14)21(24)25/h6-9,12,16-17H,10-11,13H2,1-5H3/t16-,17-/m1/s1 |
| InChIKey | DXXYYARSNPARIC-IAGOWNOFSA-N |
| XLogP | 3.89 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|