C22H32N4O7Si — CID 57093515
(4-nitrophenyl)methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 57093515) has the molecular formula C22H32N4O7Si and a molecular weight of 492.61 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57093515 |
| Molecular Formula | C22H32N4O7Si |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4-hydroxy-2-oxo-1H-imidazol-3-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](Cn2c(O)c[nH]c2=O)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C22H32N4O7Si/c1-22(2,3)34(4,5)33-18-10-17(12-25-19(27)11-23-20(25)28)24(13-18)21(29)32-14-15-6-8-16(9-7-15)26(30)31/h6-9,11,17-18,27H,10,12-14H2,1-5H3,(H,23,28)/t17-,18+/m0/s1 |
| InChIKey | HEXCBKGDEUKYII-ZWKOTPCHSA-N |
| XLogP | 3.59 |
| TPSA | 139.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|