C26H40N4O9SSi — CID 67664457
2-[[2-[2-[[4-[tert-butyl(dimethyl)silyl]oxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]methylsulfanyl]propanoylamino]acetyl]amino]acetic acid (PubChem CID 67664457) has the molecular formula C26H40N4O9SSi and a molecular weight of 612.78 g/mol. Its IUPAC name is 2-[[2-[2-[[4-[tert-butyl(dimethyl)silyl]oxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]methylsulfanyl]propanoylamino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[2-[[4-[tert-butyl(dimethyl)silyl]oxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]methylsulfanyl]propanoylamino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 67664457 |
| Molecular Formula | C26H40N4O9SSi |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | 2-[[2-[2-[[4-[tert-butyl(dimethyl)silyl]oxy-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-2-yl]methylsulfanyl]propanoylamino]acetyl]amino]acetic acid |
| SMILES | CC(SCC1CC(O[Si](C)(C)C(C)(C)C)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C26H40N4O9SSi/c1-17(24(34)28-12-22(31)27-13-23(32)33)40-16-20-11-21(39-41(5,6)26(2,3)4)14-29(20)25(35)38-15-18-7-9-19(10-8-18)30(36)37/h7-10,17,20-21H,11-16H2,1-6H3,(H,27,31)(H,28,34)(H,32,33) |
| InChIKey | JRTHPXJJRDOYMW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 177.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|