C24H33N3O5SSi — CID 57258346
(4-nitrophenyl)methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(pyridin-4-ylsulfanylmethyl)pyrrolidine-1-carboxylate (PubChem CID 57258346) has the molecular formula C24H33N3O5SSi and a molecular weight of 503.70 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(pyridin-4-ylsulfanylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(pyridin-4-ylsulfanylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57258346 |
| Molecular Formula | C24H33N3O5SSi |
| Molecular Weight | 503.70 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(pyridin-4-ylsulfanylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](CSc2ccncc2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C24H33N3O5SSi/c1-24(2,3)34(4,5)32-21-14-20(17-33-22-10-12-25-13-11-22)26(15-21)23(28)31-16-18-6-8-19(9-7-18)27(29)30/h6-13,20-21H,14-17H2,1-5H3/t20-,21+/m0/s1 |
| InChIKey | YZSPJAXCYFHECG-LEWJYISDSA-N |
| XLogP | 5.88 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|