C21H32N6O5SSi — CID 19990951
(4-nitrophenyl)methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(1-methyltetrazol-5-yl)sulfanylmethyl]pyrrolidine-1-carboxylate (PubChem CID 19990951) has the molecular formula C21H32N6O5SSi and a molecular weight of 508.68 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(1-methyltetrazol-5-yl)sulfanylmethyl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(1-methyltetrazol-5-yl)sulfanylmethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 19990951 |
| Molecular Formula | C21H32N6O5SSi |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | (4-nitrophenyl)methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(1-methyltetrazol-5-yl)sulfanylmethyl]pyrrolidine-1-carboxylate |
| SMILES | Cn1nnnc1SCC1CC(O[Si](C)(C)C(C)(C)C)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H32N6O5SSi/c1-21(2,3)34(5,6)32-18-11-17(14-33-19-22-23-24-25(19)4)26(12-18)20(28)31-13-15-7-9-16(10-8-15)27(29)30/h7-10,17-18H,11-14H2,1-6H3 |
| InChIKey | YYTBWTYNUXDHOU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|