C18H22N4O9S — CID 18639280
(4-nitrophenyl)methyl (2S,4R)-2-(3-methyl-2-oxoimidazolidine-1-carbonyl)-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 18639280) has the molecular formula C18H22N4O9S and a molecular weight of 470.46 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-2-(3-methyl-2-oxoimidazolidine-1-carbonyl)-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-2-(3-methyl-2-oxoimidazolidine-1-carbonyl)-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18639280 |
| Molecular Formula | C18H22N4O9S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-2-(3-methyl-2-oxoimidazolidine-1-carbonyl)-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CN1CCN(C(=O)[C@@H]2C[C@@H](OS(C)(=O)=O)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C18H22N4O9S/c1-19-7-8-20(17(19)24)16(23)15-9-14(31-32(2,28)29)10-21(15)18(25)30-11-12-3-5-13(6-4-12)22(26)27/h3-6,14-15H,7-11H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | YZSBQMKBGFLHKC-CABCVRRESA-N |
| XLogP | 0.54 |
| TPSA | 156.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|