C25H30N4O12S — CID 10675232
(4-nitrophenyl)methyl (2S,4R)-2-[(1R)-1-hydroxy-4-[(4-nitrophenyl)methoxycarbonylamino]butyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 10675232) has the molecular formula C25H30N4O12S and a molecular weight of 610.60 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-2-[(1R)-1-hydroxy-4-[(4-nitrophenyl)methoxycarbonylamino]butyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-2-[(1R)-1-hydroxy-4-[(4-nitrophenyl)methoxycarbonylamino]butyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10675232 |
| Molecular Formula | C25H30N4O12S |
| Molecular Weight | 610.60 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-2-[(1R)-1-hydroxy-4-[(4-nitrophenyl)methoxycarbonylamino]butyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CS(=O)(=O)O[C@@H]1C[C@@H]([C@H](O)CCCNC(=O)OCc2ccc([N+](=O)[O-])cc2)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C25H30N4O12S/c1-42(37,38)41-21-13-22(27(14-21)25(32)40-16-18-6-10-20(11-7-18)29(35)36)23(30)3-2-12-26-24(31)39-15-17-4-8-19(9-5-17)28(33)34/h4-11,21-23,30H,2-3,12-16H2,1H3,(H,26,31)/t21-,22+,23-/m1/s1 |
| InChIKey | UVTWJPIZNXQBHS-XPWALMASSA-N |
| XLogP | 2.63 |
| TPSA | 217.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.60 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|