C30H32N2O12S2 — CID 19708750
(4-nitrophenyl)methyl 2-[acetyloxy-[4-[4-(methylsulfonyloxymethyl)phenyl]phenyl]methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 19708750) has the molecular formula C30H32N2O12S2 and a molecular weight of 676.72 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[acetyloxy-[4-[4-(methylsulfonyloxymethyl)phenyl]phenyl]methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2-[acetyloxy-[4-[4-(methylsulfonyloxymethyl)phenyl]phenyl]methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 19708750 |
| Molecular Formula | C30H32N2O12S2 |
| Molecular Weight | 676.72 g/mol |
| Exact Mass | 676.14 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[acetyloxy-[4-[4-(methylsulfonyloxymethyl)phenyl]phenyl]methyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CC(=O)OC(c1ccc(-c2ccc(COS(C)(=O)=O)cc2)cc1)C1CC(OS(C)(=O)=O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H32N2O12S2/c1-20(33)43-29(25-12-10-24(11-13-25)23-8-4-22(5-9-23)19-42-45(2,37)38)28-16-27(44-46(3,39)40)17-31(28)30(34)41-18-21-6-14-26(15-7-21)32(35)36/h4-15,27-29H,16-19H2,1-3H3 |
| InChIKey | SDXJYDIQGRVTNC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 185.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|