C24H25N5O10 — CID 18657859
(4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[4-[(4-nitrophenyl)methoxycarbonylamino]-5-oxopyrrolidin-3-yl]pyrrolidine-1-carboxylate (PubChem CID 18657859) has the molecular formula C24H25N5O10 and a molecular weight of 543.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[4-[(4-nitrophenyl)methoxycarbonylamino]-5-oxopyrrolidin-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[4-[(4-nitrophenyl)methoxycarbonylamino]-5-oxopyrrolidin-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18657859 |
| Molecular Formula | C24H25N5O10 |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[4-[(4-nitrophenyl)methoxycarbonylamino]-5-oxopyrrolidin-3-yl]pyrrolidine-1-carboxylate |
| SMILES | O=C(NC1C(=O)NCC1[C@@H]1C[C@@H](O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H25N5O10/c30-18-9-20(27(11-18)24(33)39-13-15-3-7-17(8-4-15)29(36)37)19-10-25-22(31)21(19)26-23(32)38-12-14-1-5-16(6-2-14)28(34)35/h1-8,18-21,30H,9-13H2,(H,25,31)(H,26,32)/t18-,19?,20+,21?/m1/s1 |
| InChIKey | WHZDLAZBKWHRDL-OSIBBQKWSA-N |
| XLogP | 1.62 |
| TPSA | 203.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|