C16H19N3O6 — CID 10831630
(4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[(3S)-5-oxopyrrolidin-3-yl]pyrrolidine-1-carboxylate (PubChem CID 10831630) has the molecular formula C16H19N3O6 and a molecular weight of 349.34 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[(3S)-5-oxopyrrolidin-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[(3S)-5-oxopyrrolidin-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10831630 |
| Molecular Formula | C16H19N3O6 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-4-hydroxy-2-[(3S)-5-oxopyrrolidin-3-yl]pyrrolidine-1-carboxylate |
| SMILES | O=C1C[C@H]([C@@H]2C[C@@H](O)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)CN1 |
| InChI | InChI=1S/C16H19N3O6/c20-13-6-14(11-5-15(21)17-7-11)18(8-13)16(22)25-9-10-1-3-12(4-2-10)19(23)24/h1-4,11,13-14,20H,5-9H2,(H,17,21)/t11-,13+,14-/m0/s1 |
| InChIKey | SDGQAWAVCIYNRG-YUTCNCBUSA-N |
| XLogP | 0.80 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|