C30H39N7O12S2 — CID 161170594
(4-nitrophenyl)methyl 2-(dimethylcarbamoyl)-4-sulfamoylpyrrolidine-1-carboxylate;(4-nitrophenyl)methyl 2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 161170594) has the molecular formula C30H39N7O12S2 and a molecular weight of 753.81 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(dimethylcarbamoyl)-4-sulfamoylpyrrolidine-1-carboxylate;(4-nitrophenyl)methyl 2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2-(dimethylcarbamoyl)-4-sulfamoylpyrrolidine-1-carboxylate;(4-nitrophenyl)methyl 2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 161170594 |
| Molecular Formula | C30H39N7O12S2 |
| Molecular Weight | 753.81 g/mol |
| Exact Mass | 753.21 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(dimethylcarbamoyl)-4-sulfamoylpyrrolidine-1-carboxylate;(4-nitrophenyl)methyl 2-(dimethylcarbamoyl)-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | CN(C)C(=O)C1CC(S(N)(=O)=O)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1.CN(C)C(=O)C1CC(S)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H20N4O7S.C15H19N3O5S/c1-17(2)14(20)13-7-12(27(16,24)25)8-18(13)15(21)26-9-10-3-5-11(6-4-10)19(22)23;1-16(2)14(19)13-7-12(24)8-17(13)15(20)23-9-10-3-5-11(6-4-10)18(21)22/h3-6,12-13H,7-9H2,1-2H3,(H2,16,24,25);3-6,12-13,24H,7-9H2,1-2H3 |
| InChIKey | URCWDRFTCNXGSV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 246.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.81 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|