C15H18BrN3O5 — CID 163211698
(4-nitrophenyl)methyl (2R,4S)-4-bromo-2-(dimethylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 163211698) has the molecular formula C15H18BrN3O5 and a molecular weight of 400.23 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,4S)-4-bromo-2-(dimethylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,4S)-4-bromo-2-(dimethylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163211698 |
| Molecular Formula | C15H18BrN3O5 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,4S)-4-bromo-2-(dimethylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | CN(C)C(=O)[C@H]1C[C@H](Br)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H18BrN3O5/c1-17(2)14(20)13-7-11(16)8-18(13)15(21)24-9-10-3-5-12(6-4-10)19(22)23/h3-6,11,13H,7-9H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | MFRRUZQNBJJZBH-WCQYABFASA-N |
| XLogP | 2.16 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|