C24H26N4O5S — CID 19965523
benzyl 2-[4-[3-(4-carbamothioylphenyl)-2-oxo-1,3-oxazolidine-5-carbonyl]piperazin-1-yl]acetate (PubChem CID 19965523) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is benzyl 2-[4-[3-(4-carbamothioylphenyl)-2-oxo-1,3-oxazolidine-5-carbonyl]piperazin-1-yl]acetate.
| Compound Name | benzyl 2-[4-[3-(4-carbamothioylphenyl)-2-oxo-1,3-oxazolidine-5-carbonyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 19965523 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | benzyl 2-[4-[3-(4-carbamothioylphenyl)-2-oxo-1,3-oxazolidine-5-carbonyl]piperazin-1-yl]acetate |
| SMILES | NC(=S)c1ccc(N2CC(C(=O)N3CCN(CC(=O)OCc4ccccc4)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C24H26N4O5S/c25-22(34)18-6-8-19(9-7-18)28-14-20(33-24(28)31)23(30)27-12-10-26(11-13-27)15-21(29)32-16-17-4-2-1-3-5-17/h1-9,20H,10-16H2,(H2,25,34) |
| InChIKey | JXXZYIGRIZXPDS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|