C29H31N5O5S — CID 22435036
benzyl 2-[4-[[2-oxo-3-[4-[N'-(thiophene-3-carbonyl)carbamimidoyl]phenyl]-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]acetate (PubChem CID 22435036) has the molecular formula C29H31N5O5S and a molecular weight of 561.66 g/mol. Its IUPAC name is benzyl 2-[4-[[2-oxo-3-[4-[N'-(thiophene-3-carbonyl)carbamimidoyl]phenyl]-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]acetate.
| Compound Name | benzyl 2-[4-[[2-oxo-3-[4-[N'-(thiophene-3-carbonyl)carbamimidoyl]phenyl]-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 22435036 |
| Molecular Formula | C29H31N5O5S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | benzyl 2-[4-[[2-oxo-3-[4-[N'-(thiophene-3-carbonyl)carbamimidoyl]phenyl]-1,3-oxazolidin-5-yl]methyl]piperazin-1-yl]acetate |
| SMILES | N/C(=N\C(=O)c1ccsc1)c1ccc(N2CC(CN3CCN(CC(=O)OCc4ccccc4)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C29H31N5O5S/c30-27(31-28(36)23-10-15-40-20-23)22-6-8-24(9-7-22)34-17-25(39-29(34)37)16-32-11-13-33(14-12-32)18-26(35)38-19-21-4-2-1-3-5-21/h1-10,15,20,25H,11-14,16-19H2,(H2,30,31,36) |
| InChIKey | VPVHFWWZOFTWJG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|