C23H25N5O5 — CID 10225915
4-[[3-[4-(N'-benzoylcarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazine-1-carboxylic acid (PubChem CID 10225915) has the molecular formula C23H25N5O5 and a molecular weight of 451.48 g/mol. Its IUPAC name is 4-[[3-[4-(N'-benzoylcarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[3-[4-(N'-benzoylcarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 10225915 |
| Molecular Formula | C23H25N5O5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 4-[[3-[4-(N'-benzoylcarbamimidoyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazine-1-carboxylic acid |
| SMILES | N/C(=N\C(=O)c1ccccc1)c1ccc(N2CC(CN3CCN(C(=O)O)CC3)OC2=O)cc1 |
| InChI | InChI=1S/C23H25N5O5/c24-20(25-21(29)17-4-2-1-3-5-17)16-6-8-18(9-7-16)28-15-19(33-23(28)32)14-26-10-12-27(13-11-26)22(30)31/h1-9,19H,10-15H2,(H,30,31)(H2,24,25,29) |
| InChIKey | FAHJNJUUZQCEDB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 128.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|